About 6,6-diaminohexanenitrile
6,6-diaminohexanenitrile (PubChem CID 19597239) has the molecular formula C6H13N3
and a molecular weight of 127.19 g/mol. Its IUPAC name is 6,6-diaminohexanenitrile.
Molecular Properties
| Compound Name | 6,6-diaminohexanenitrile |
| PubChem CID | 19597239 |
| Molecular Formula | C6H13N3 |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.11 |
| IUPAC Name | 6,6-diaminohexanenitrile |
| SMILES | N#CCCCCC(N)N |
| InChI | InChI=1S/C6H13N3/c7-5-3-1-2-4-6(8)9/h6H,1-4,8-9H2 |
| InChIKey | JPHWOQCURLNAHY-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 6,6-diaminohexanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-diaminohexanenitrile?
The IUPAC name of 6,6-diaminohexanenitrile (CID 19597239) is 6,6-diaminohexanenitrile.
What is the SMILES notation for 6,6-diaminohexanenitrile?
The canonical SMILES for 6,6-diaminohexanenitrile is N#CCCCCC(N)N.
What is the InChIKey of 6,6-diaminohexanenitrile?
The InChIKey is JPHWOQCURLNAHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3/c7-5-3-1-2-4-6(8)9/h6H,1-4,8-9H2.
What are the key properties of 6,6-diaminohexanenitrile?
6,6-diaminohexanenitrile has a molecular weight of 127.19 g/mol, XLogP of 0.31, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-diaminohexanenitrile is sourced from PubChem (CID 19597239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).