C22H22N4O2 — CID 19597536
4-[4-(4-amino-7-tert-butylpyrrolo[2,3-d]pyrimidin-5-yl)phenoxy]phenol (PubChem CID 19597536) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is 4-[4-(4-amino-7-tert-butylpyrrolo[2,3-d]pyrimidin-5-yl)phenoxy]phenol.
| Compound Name | 4-[4-(4-amino-7-tert-butylpyrrolo[2,3-d]pyrimidin-5-yl)phenoxy]phenol |
|---|---|
| PubChem CID | 19597536 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 4-[4-(4-amino-7-tert-butylpyrrolo[2,3-d]pyrimidin-5-yl)phenoxy]phenol |
| SMILES | CC(C)(C)n1cc(-c2ccc(Oc3ccc(O)cc3)cc2)c2c(N)ncnc21 |
| InChI | InChI=1S/C22H22N4O2/c1-22(2,3)26-12-18(19-20(23)24-13-25-21(19)26)14-4-8-16(9-5-14)28-17-10-6-15(27)7-11-17/h4-13,27H,1-3H3,(H2,23,24,25) |
| InChIKey | YAUXUMSQGNPGQC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |