About 6-amino-5-methyl-1H-pyrimidin-2-one;1H-pyrimidine-2,4-dione
6-amino-5-methyl-1H-pyrimidin-2-one;1H-pyrimidine-2,4-dione (PubChem CID 19597542) has the molecular formula C9H11N5O3
and a molecular weight of 237.22 g/mol. Its IUPAC name is 6-amino-5-methyl-1H-pyrimidin-2-one;1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-amino-5-methyl-1H-pyrimidin-2-one;1H-pyrimidine-2,4-dione |
| PubChem CID | 19597542 |
| Molecular Formula | C9H11N5O3 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 6-amino-5-methyl-1H-pyrimidin-2-one;1H-pyrimidine-2,4-dione |
| SMILES | Cc1cnc(=O)[nH]c1N.O=c1cc[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C5H7N3O.C4H4N2O2/c1-3-2-7-5(9)8-4(3)6;7-3-1-2-5-4(8)6-3/h2H,1H3,(H3,6,7,8,9);1-2H,(H2,5,6,7,8) |
| InChIKey | OWCGYGKWHXMMBD-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 137.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-amino-5-methyl-1H-pyrimidin-2-one;1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-5-methyl-1H-pyrimidin-2-one;1H-pyrimidine-2,4-dione?
The IUPAC name of 6-amino-5-methyl-1H-pyrimidin-2-one;1H-pyrimidine-2,4-dione (CID 19597542) is 6-amino-5-methyl-1H-pyrimidin-2-one;1H-pyrimidine-2,4-dione.
What is the SMILES notation for 6-amino-5-methyl-1H-pyrimidin-2-one;1H-pyrimidine-2,4-dione?
The canonical SMILES for 6-amino-5-methyl-1H-pyrimidin-2-one;1H-pyrimidine-2,4-dione is Cc1cnc(=O)[nH]c1N.O=c1cc[nH]c(=O)[nH]1.
What is the InChIKey of 6-amino-5-methyl-1H-pyrimidin-2-one;1H-pyrimidine-2,4-dione?
The InChIKey is OWCGYGKWHXMMBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O.C4H4N2O2/c1-3-2-7-5(9)8-4(3)6;7-3-1-2-5-4(8)6-3/h2H,1H3,(H3,6,7,8,9);1-2H,(H2,5,6,7,8).
What are the key properties of 6-amino-5-methyl-1H-pyrimidin-2-one;1H-pyrimidine-2,4-dione?
6-amino-5-methyl-1H-pyrimidin-2-one;1H-pyrimidine-2,4-dione has a molecular weight of 237.22 g/mol, XLogP of -1.28, 0 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-5-methyl-1H-pyrimidin-2-one;1H-pyrimidine-2,4-dione is sourced from PubChem (CID 19597542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).