About 2-(1-methylpyrrolidin-2-yl)furo[3,2-b]pyridine
2-(1-methylpyrrolidin-2-yl)furo[3,2-b]pyridine (PubChem CID 19597631) has the molecular formula C12H14N2O
and a molecular weight of 202.26 g/mol. Its IUPAC name is 2-(1-methylpyrrolidin-2-yl)furo[3,2-b]pyridine.
Molecular Properties
| Compound Name | 2-(1-methylpyrrolidin-2-yl)furo[3,2-b]pyridine |
| PubChem CID | 19597631 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 2-(1-methylpyrrolidin-2-yl)furo[3,2-b]pyridine |
| SMILES | CN1CCCC1c1cc2ncccc2o1 |
| InChI | InChI=1S/C12H14N2O/c1-14-7-3-4-10(14)12-8-9-11(15-12)5-2-6-13-9/h2,5-6,8,10H,3-4,7H2,1H3 |
| InChIKey | BJFLPKJLIFUESE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1-methylpyrrolidin-2-yl)furo[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methylpyrrolidin-2-yl)furo[3,2-b]pyridine?
The IUPAC name of 2-(1-methylpyrrolidin-2-yl)furo[3,2-b]pyridine (CID 19597631) is 2-(1-methylpyrrolidin-2-yl)furo[3,2-b]pyridine.
What is the SMILES notation for 2-(1-methylpyrrolidin-2-yl)furo[3,2-b]pyridine?
The canonical SMILES for 2-(1-methylpyrrolidin-2-yl)furo[3,2-b]pyridine is CN1CCCC1c1cc2ncccc2o1.
What is the InChIKey of 2-(1-methylpyrrolidin-2-yl)furo[3,2-b]pyridine?
The InChIKey is BJFLPKJLIFUESE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O/c1-14-7-3-4-10(14)12-8-9-11(15-12)5-2-6-13-9/h2,5-6,8,10H,3-4,7H2,1H3.
What are the key properties of 2-(1-methylpyrrolidin-2-yl)furo[3,2-b]pyridine?
2-(1-methylpyrrolidin-2-yl)furo[3,2-b]pyridine has a molecular weight of 202.26 g/mol, XLogP of 2.59, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methylpyrrolidin-2-yl)furo[3,2-b]pyridine is sourced from PubChem (CID 19597631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).