About furo[3,2-b]pyridine;hydrochloride
furo[3,2-b]pyridine;hydrochloride (PubChem CID 19597671) has the molecular formula C7H6ClNO
and a molecular weight of 155.58 g/mol. Its IUPAC name is furo[3,2-b]pyridine;hydrochloride.
Molecular Properties
| Compound Name | furo[3,2-b]pyridine;hydrochloride |
| PubChem CID | 19597671 |
| Molecular Formula | C7H6ClNO |
| Molecular Weight | 155.58 g/mol |
| Exact Mass | 155.01 |
| IUPAC Name | furo[3,2-b]pyridine;hydrochloride |
| SMILES | Cl.c1cnc2ccoc2c1 |
| InChI | InChI=1S/C7H5NO.ClH/c1-2-7-6(8-4-1)3-5-9-7;/h1-5H;1H |
| InChIKey | JKUYABTYDBWWJP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.58 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze furo[3,2-b]pyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furo[3,2-b]pyridine;hydrochloride?
The IUPAC name of furo[3,2-b]pyridine;hydrochloride (CID 19597671) is furo[3,2-b]pyridine;hydrochloride.
What is the SMILES notation for furo[3,2-b]pyridine;hydrochloride?
The canonical SMILES for furo[3,2-b]pyridine;hydrochloride is Cl.c1cnc2ccoc2c1.
What is the InChIKey of furo[3,2-b]pyridine;hydrochloride?
The InChIKey is JKUYABTYDBWWJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO.ClH/c1-2-7-6(8-4-1)3-5-9-7;/h1-5H;1H.
What are the key properties of furo[3,2-b]pyridine;hydrochloride?
furo[3,2-b]pyridine;hydrochloride has a molecular weight of 155.58 g/mol, XLogP of 2.25, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for furo[3,2-b]pyridine;hydrochloride is sourced from PubChem (CID 19597671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).