About 5-iodo-1H-triazin-6-one
5-iodo-1H-triazin-6-one (PubChem CID 19597707) has the molecular formula C3H2IN3O
and a molecular weight of 222.97 g/mol. Its IUPAC name is 5-iodo-1H-triazin-6-one.
Molecular Properties
| Compound Name | 5-iodo-1H-triazin-6-one |
| PubChem CID | 19597707 |
| Molecular Formula | C3H2IN3O |
| Molecular Weight | 222.97 g/mol |
| Exact Mass | 222.92 |
| IUPAC Name | 5-iodo-1H-triazin-6-one |
| SMILES | O=c1[nH]nncc1I |
| InChI | InChI=1S/C3H2IN3O/c4-2-1-5-7-6-3(2)8/h1H,(H,5,6,8) |
| InChIKey | GPHVWFSPRGQKSA-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.97 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-1H-triazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-1H-triazin-6-one?
The IUPAC name of 5-iodo-1H-triazin-6-one (CID 19597707) is 5-iodo-1H-triazin-6-one.
What is the SMILES notation for 5-iodo-1H-triazin-6-one?
The canonical SMILES for 5-iodo-1H-triazin-6-one is O=c1[nH]nncc1I.
What is the InChIKey of 5-iodo-1H-triazin-6-one?
The InChIKey is GPHVWFSPRGQKSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H2IN3O/c4-2-1-5-7-6-3(2)8/h1H,(H,5,6,8).
What are the key properties of 5-iodo-1H-triazin-6-one?
5-iodo-1H-triazin-6-one has a molecular weight of 222.97 g/mol, XLogP of -0.23, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-1H-triazin-6-one is sourced from PubChem (CID 19597707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).