About 2-(2-chloro-1-benzothiophen-3-yl)-6,6,6-trifluorohexan-1-amine
2-(2-chloro-1-benzothiophen-3-yl)-6,6,6-trifluorohexan-1-amine (PubChem CID 19597984) has the molecular formula C14H15ClF3NS
and a molecular weight of 321.80 g/mol. Its IUPAC name is 2-(2-chloro-1-benzothiophen-3-yl)-6,6,6-trifluorohexan-1-amine.
Molecular Properties
| Compound Name | 2-(2-chloro-1-benzothiophen-3-yl)-6,6,6-trifluorohexan-1-amine |
| PubChem CID | 19597984 |
| Molecular Formula | C14H15ClF3NS |
| Molecular Weight | 321.80 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 2-(2-chloro-1-benzothiophen-3-yl)-6,6,6-trifluorohexan-1-amine |
| SMILES | NCC(CCCC(F)(F)F)c1c(Cl)sc2ccccc12 |
| InChI | InChI=1S/C14H15ClF3NS/c15-13-12(10-5-1-2-6-11(10)20-13)9(8-19)4-3-7-14(16,17)18/h1-2,5-6,9H,3-4,7-8,19H2 |
| InChIKey | HDMKRUBMHLWXFH-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 321.80 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-chloro-1-benzothiophen-3-yl)-6,6,6-trifluorohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chloro-1-benzothiophen-3-yl)-6,6,6-trifluorohexan-1-amine?
The IUPAC name of 2-(2-chloro-1-benzothiophen-3-yl)-6,6,6-trifluorohexan-1-amine (CID 19597984) is 2-(2-chloro-1-benzothiophen-3-yl)-6,6,6-trifluorohexan-1-amine.
What is the SMILES notation for 2-(2-chloro-1-benzothiophen-3-yl)-6,6,6-trifluorohexan-1-amine?
The canonical SMILES for 2-(2-chloro-1-benzothiophen-3-yl)-6,6,6-trifluorohexan-1-amine is NCC(CCCC(F)(F)F)c1c(Cl)sc2ccccc12.
What is the InChIKey of 2-(2-chloro-1-benzothiophen-3-yl)-6,6,6-trifluorohexan-1-amine?
The InChIKey is HDMKRUBMHLWXFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15ClF3NS/c15-13-12(10-5-1-2-6-11(10)20-13)9(8-19)4-3-7-14(16,17)18/h1-2,5-6,9H,3-4,7-8,19H2.
What are the key properties of 2-(2-chloro-1-benzothiophen-3-yl)-6,6,6-trifluorohexan-1-amine?
2-(2-chloro-1-benzothiophen-3-yl)-6,6,6-trifluorohexan-1-amine has a molecular weight of 321.80 g/mol, XLogP of 5.33, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chloro-1-benzothiophen-3-yl)-6,6,6-trifluorohexan-1-amine is sourced from PubChem (CID 19597984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).