C26H35NO4 — CID 19598037
tert-butyl 3-[5-amino-2-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]phenyl]propanoate (PubChem CID 19598037) has the molecular formula C26H35NO4 and a molecular weight of 425.57 g/mol. Its IUPAC name is tert-butyl 3-[5-amino-2-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]phenyl]propanoate.
| Compound Name | tert-butyl 3-[5-amino-2-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 19598037 |
| Molecular Formula | C26H35NO4 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | tert-butyl 3-[5-amino-2-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]phenyl]propanoate |
| SMILES | COc1ccc(/C=C/CCCCOc2ccc(N)cc2CCC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C26H35NO4/c1-26(2,3)31-25(28)17-12-21-19-22(27)13-16-24(21)30-18-8-6-5-7-9-20-10-14-23(29-4)15-11-20/h7,9-11,13-16,19H,5-6,8,12,17-18,27H2,1-4H3/b9-7+ |
| InChIKey | RFVYABNISNUUNK-VQHVLOKHSA-N |
| XLogP | 5.81 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|