C14H18F2O2S — CID 19598275
2,2-difluoro-3-hydroxy-3-phenyloctanethioic S-acid (PubChem CID 19598275) has the molecular formula C14H18F2O2S and a molecular weight of 288.36 g/mol. Its IUPAC name is 2,2-difluoro-3-hydroxy-3-phenyloctanethioic S-acid.
| Compound Name | 2,2-difluoro-3-hydroxy-3-phenyloctanethioic S-acid |
|---|---|
| PubChem CID | 19598275 |
| Molecular Formula | C14H18F2O2S |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 2,2-difluoro-3-hydroxy-3-phenyloctanethioic S-acid |
| SMILES | CCCCCC(O)(c1ccccc1)C(F)(F)C(=O)S |
| InChI | InChI=1S/C14H18F2O2S/c1-2-3-7-10-13(18,14(15,16)12(17)19)11-8-5-4-6-9-11/h4-6,8-9,18H,2-3,7,10H2,1H3,(H,17,19) |
| InChIKey | HNRPNMOTUMVVGQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|