About S-[(4Z)-cyclooct-4-en-1-yl] 2,2-difluoroethanethioate
S-[(4Z)-cyclooct-4-en-1-yl] 2,2-difluoroethanethioate (PubChem CID 19598291) has the molecular formula C10H14F2OS
and a molecular weight of 220.28 g/mol. Its IUPAC name is S-[(4Z)-cyclooct-4-en-1-yl] 2,2-difluoroethanethioate.
Molecular Properties
| Compound Name | S-[(4Z)-cyclooct-4-en-1-yl] 2,2-difluoroethanethioate |
| PubChem CID | 19598291 |
| Molecular Formula | C10H14F2OS |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | S-[(4Z)-cyclooct-4-en-1-yl] 2,2-difluoroethanethioate |
| SMILES | O=C(SC1CC/C=C\CCC1)C(F)F |
| InChI | InChI=1S/C10H14F2OS/c11-9(12)10(13)14-8-6-4-2-1-3-5-7-8/h1-2,8-9H,3-7H2/b2-1- |
| InChIKey | IWULNRNLKZSTFK-UPHRSURJSA-N |
| XLogP | 3.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[(4Z)-cyclooct-4-en-1-yl] 2,2-difluoroethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[(4Z)-cyclooct-4-en-1-yl] 2,2-difluoroethanethioate?
The IUPAC name of S-[(4Z)-cyclooct-4-en-1-yl] 2,2-difluoroethanethioate (CID 19598291) is S-[(4Z)-cyclooct-4-en-1-yl] 2,2-difluoroethanethioate.
What is the SMILES notation for S-[(4Z)-cyclooct-4-en-1-yl] 2,2-difluoroethanethioate?
The canonical SMILES for S-[(4Z)-cyclooct-4-en-1-yl] 2,2-difluoroethanethioate is O=C(SC1CC/C=C\CCC1)C(F)F.
What is the InChIKey of S-[(4Z)-cyclooct-4-en-1-yl] 2,2-difluoroethanethioate?
The InChIKey is IWULNRNLKZSTFK-UPHRSURJSA-N. The full InChI is InChI=1S/C10H14F2OS/c11-9(12)10(13)14-8-6-4-2-1-3-5-7-8/h1-2,8-9H,3-7H2/b2-1-.
What are the key properties of S-[(4Z)-cyclooct-4-en-1-yl] 2,2-difluoroethanethioate?
S-[(4Z)-cyclooct-4-en-1-yl] 2,2-difluoroethanethioate has a molecular weight of 220.28 g/mol, XLogP of 3.40, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-[(4Z)-cyclooct-4-en-1-yl] 2,2-difluoroethanethioate is sourced from PubChem (CID 19598291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).