About barium(2+);bis(2-butoxyethanolate)
barium(2+);bis(2-butoxyethanolate) (PubChem CID 19598526) has the molecular formula C12H26BaO4
and a molecular weight of 371.66 g/mol. Its IUPAC name is barium(2+);bis(2-butoxyethanolate).
Molecular Properties
| Compound Name | barium(2+);bis(2-butoxyethanolate) |
| PubChem CID | 19598526 |
| Molecular Formula | C12H26BaO4 |
| Molecular Weight | 371.66 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | barium(2+);bis(2-butoxyethanolate) |
| SMILES | CCCCOCC[O-].CCCCOCC[O-].[Ba+2] |
| InChI | InChI=1S/2C6H13O2.Ba/c2*1-2-3-5-8-6-4-7;/h2*2-6H2,1H3;/q2*-1;+2 |
| InChIKey | SYLKUNOIMBJPOL-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 64.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.66 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);bis(2-butoxyethanolate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);bis(2-butoxyethanolate)?
The IUPAC name of barium(2+);bis(2-butoxyethanolate) (CID 19598526) is barium(2+);bis(2-butoxyethanolate).
What is the SMILES notation for barium(2+);bis(2-butoxyethanolate)?
The canonical SMILES for barium(2+);bis(2-butoxyethanolate) is CCCCOCC[O-].CCCCOCC[O-].[Ba+2].
What is the InChIKey of barium(2+);bis(2-butoxyethanolate)?
The InChIKey is SYLKUNOIMBJPOL-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H13O2.Ba/c2*1-2-3-5-8-6-4-7;/h2*2-6H2,1H3;/q2*-1;+2.
What are the key properties of barium(2+);bis(2-butoxyethanolate)?
barium(2+);bis(2-butoxyethanolate) has a molecular weight of 371.66 g/mol, XLogP of -0.05, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);bis(2-butoxyethanolate) is sourced from PubChem (CID 19598526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).