About 1,3-dichloro-5-ethylsulfanyl-1,3,5-triazinane
1,3-dichloro-5-ethylsulfanyl-1,3,5-triazinane (PubChem CID 19598910) has the molecular formula C5H11Cl2N3S
and a molecular weight of 216.14 g/mol. Its IUPAC name is 1,3-dichloro-5-ethylsulfanyl-1,3,5-triazinane.
Molecular Properties
| Compound Name | 1,3-dichloro-5-ethylsulfanyl-1,3,5-triazinane |
| PubChem CID | 19598910 |
| Molecular Formula | C5H11Cl2N3S |
| Molecular Weight | 216.14 g/mol |
| Exact Mass | 215.01 |
| IUPAC Name | 1,3-dichloro-5-ethylsulfanyl-1,3,5-triazinane |
| SMILES | CCSN1CN(Cl)CN(Cl)C1 |
| InChI | InChI=1S/C5H11Cl2N3S/c1-2-11-10-4-8(6)3-9(7)5-10/h2-5H2,1H3 |
| InChIKey | LHIAGXPCTVYINJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.14 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dichloro-5-ethylsulfanyl-1,3,5-triazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dichloro-5-ethylsulfanyl-1,3,5-triazinane?
The IUPAC name of 1,3-dichloro-5-ethylsulfanyl-1,3,5-triazinane (CID 19598910) is 1,3-dichloro-5-ethylsulfanyl-1,3,5-triazinane.
What is the SMILES notation for 1,3-dichloro-5-ethylsulfanyl-1,3,5-triazinane?
The canonical SMILES for 1,3-dichloro-5-ethylsulfanyl-1,3,5-triazinane is CCSN1CN(Cl)CN(Cl)C1.
What is the InChIKey of 1,3-dichloro-5-ethylsulfanyl-1,3,5-triazinane?
The InChIKey is LHIAGXPCTVYINJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11Cl2N3S/c1-2-11-10-4-8(6)3-9(7)5-10/h2-5H2,1H3.
What are the key properties of 1,3-dichloro-5-ethylsulfanyl-1,3,5-triazinane?
1,3-dichloro-5-ethylsulfanyl-1,3,5-triazinane has a molecular weight of 216.14 g/mol, XLogP of 1.75, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dichloro-5-ethylsulfanyl-1,3,5-triazinane is sourced from PubChem (CID 19598910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).