C14H24NO2- — CID 19598977
(E)-2-methyl-3-(1,2,2,6,6-pentamethylpiperidin-4-yl)prop-2-enoate (PubChem CID 19598977) has the molecular formula C14H24NO2- and a molecular weight of 238.35 g/mol. Its IUPAC name is (E)-2-methyl-3-(1,2,2,6,6-pentamethylpiperidin-4-yl)prop-2-enoate.
| Compound Name | (E)-2-methyl-3-(1,2,2,6,6-pentamethylpiperidin-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 19598977 |
| Molecular Formula | C14H24NO2- |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | (E)-2-methyl-3-(1,2,2,6,6-pentamethylpiperidin-4-yl)prop-2-enoate |
| SMILES | C/C(=C\C1CC(C)(C)N(C)C(C)(C)C1)C(=O)[O-] |
| InChI | InChI=1S/C14H25NO2/c1-10(12(16)17)7-11-8-13(2,3)15(6)14(4,5)9-11/h7,11H,8-9H2,1-6H3,(H,16,17)/p-1/b10-7+ |
| InChIKey | UIZWPVOGWBRBLX-JXMROGBWSA-M |
| XLogP | 1.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|