About 2-methyldecanethioic S-acid
2-methyldecanethioic S-acid (PubChem CID 19598987) has the molecular formula C11H22OS
and a molecular weight of 202.36 g/mol. Its IUPAC name is 2-methyldecanethioic S-acid.
Molecular Properties
| Compound Name | 2-methyldecanethioic S-acid |
| PubChem CID | 19598987 |
| Molecular Formula | C11H22OS |
| Molecular Weight | 202.36 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 2-methyldecanethioic S-acid |
| SMILES | CCCCCCCCC(C)C(=O)S |
| InChI | InChI=1S/C11H22OS/c1-3-4-5-6-7-8-9-10(2)11(12)13/h10H,3-9H2,1-2H3,(H,12,13) |
| InChIKey | MPMQOFXSGGRJAO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methyldecanethioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyldecanethioic S-acid?
The IUPAC name of 2-methyldecanethioic S-acid (CID 19598987) is 2-methyldecanethioic S-acid.
What is the SMILES notation for 2-methyldecanethioic S-acid?
The canonical SMILES for 2-methyldecanethioic S-acid is CCCCCCCCC(C)C(=O)S.
What is the InChIKey of 2-methyldecanethioic S-acid?
The InChIKey is MPMQOFXSGGRJAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22OS/c1-3-4-5-6-7-8-9-10(2)11(12)13/h10H,3-9H2,1-2H3,(H,12,13).
What are the key properties of 2-methyldecanethioic S-acid?
2-methyldecanethioic S-acid has a molecular weight of 202.36 g/mol, XLogP of 3.83, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyldecanethioic S-acid is sourced from PubChem (CID 19598987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).