C17H17NO3S — CID 19599347
3,3-dimethyl-1,1-dioxo-5-phenyl-2H-1λ6,5-benzothiazepin-4-one (PubChem CID 19599347) has the molecular formula C17H17NO3S and a molecular weight of 315.39 g/mol. Its IUPAC name is 3,3-dimethyl-1,1-dioxo-5-phenyl-2H-1λ6,5-benzothiazepin-4-one.
| Compound Name | 3,3-dimethyl-1,1-dioxo-5-phenyl-2H-1λ6,5-benzothiazepin-4-one |
|---|---|
| PubChem CID | 19599347 |
| Molecular Formula | C17H17NO3S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 3,3-dimethyl-1,1-dioxo-5-phenyl-2H-1λ6,5-benzothiazepin-4-one |
| SMILES | CC1(C)CS(=O)(=O)c2ccccc2N(c2ccccc2)C1=O |
| InChI | InChI=1S/C17H17NO3S/c1-17(2)12-22(20,21)15-11-7-6-10-14(15)18(16(17)19)13-8-4-3-5-9-13/h3-11H,12H2,1-2H3 |
| InChIKey | ARHQWWOYCRCGTE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |