About 3-butyl-3-ethyl-8-methoxy-2,5-dihydro-1,5-benzothiazepin-4-one
3-butyl-3-ethyl-8-methoxy-2,5-dihydro-1,5-benzothiazepin-4-one (PubChem CID 19599377) has the molecular formula C16H23NO2S
and a molecular weight of 293.43 g/mol. Its IUPAC name is 3-butyl-3-ethyl-8-methoxy-2,5-dihydro-1,5-benzothiazepin-4-one.
Molecular Properties
| Compound Name | 3-butyl-3-ethyl-8-methoxy-2,5-dihydro-1,5-benzothiazepin-4-one |
| PubChem CID | 19599377 |
| Molecular Formula | C16H23NO2S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 3-butyl-3-ethyl-8-methoxy-2,5-dihydro-1,5-benzothiazepin-4-one |
| SMILES | CCCCC1(CC)CSc2cc(OC)ccc2NC1=O |
| InChI | InChI=1S/C16H23NO2S/c1-4-6-9-16(5-2)11-20-14-10-12(19-3)7-8-13(14)17-15(16)18/h7-8,10H,4-6,9,11H2,1-3H3,(H,17,18) |
| InChIKey | LEEZUNKDAOGUNK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-butyl-3-ethyl-8-methoxy-2,5-dihydro-1,5-benzothiazepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-3-ethyl-8-methoxy-2,5-dihydro-1,5-benzothiazepin-4-one?
The IUPAC name of 3-butyl-3-ethyl-8-methoxy-2,5-dihydro-1,5-benzothiazepin-4-one (CID 19599377) is 3-butyl-3-ethyl-8-methoxy-2,5-dihydro-1,5-benzothiazepin-4-one.
What is the SMILES notation for 3-butyl-3-ethyl-8-methoxy-2,5-dihydro-1,5-benzothiazepin-4-one?
The canonical SMILES for 3-butyl-3-ethyl-8-methoxy-2,5-dihydro-1,5-benzothiazepin-4-one is CCCCC1(CC)CSc2cc(OC)ccc2NC1=O.
What is the InChIKey of 3-butyl-3-ethyl-8-methoxy-2,5-dihydro-1,5-benzothiazepin-4-one?
The InChIKey is LEEZUNKDAOGUNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO2S/c1-4-6-9-16(5-2)11-20-14-10-12(19-3)7-8-13(14)17-15(16)18/h7-8,10H,4-6,9,11H2,1-3H3,(H,17,18).
What are the key properties of 3-butyl-3-ethyl-8-methoxy-2,5-dihydro-1,5-benzothiazepin-4-one?
3-butyl-3-ethyl-8-methoxy-2,5-dihydro-1,5-benzothiazepin-4-one has a molecular weight of 293.43 g/mol, XLogP of 4.33, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-3-ethyl-8-methoxy-2,5-dihydro-1,5-benzothiazepin-4-one is sourced from PubChem (CID 19599377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).