About [1,3]thiazolo[3,2-a]indole
[1,3]thiazolo[3,2-a]indole (PubChem CID 19599422) has the molecular formula C10H7NS
and a molecular weight of 173.24 g/mol. Its IUPAC name is [1,3]thiazolo[3,2-a]indole.
Molecular Properties
| Compound Name | [1,3]thiazolo[3,2-a]indole |
| PubChem CID | 19599422 |
| Molecular Formula | C10H7NS |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.03 |
| IUPAC Name | [1,3]thiazolo[3,2-a]indole |
| SMILES | c1ccc2c(c1)cc1sccn12 |
| InChI | InChI=1S/C10H7NS/c1-2-4-9-8(3-1)7-10-11(9)5-6-12-10/h1-7H |
| InChIKey | NKEGHPOGONHAJP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 4.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1,3]thiazolo[3,2-a]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3]thiazolo[3,2-a]indole?
The IUPAC name of [1,3]thiazolo[3,2-a]indole (CID 19599422) is [1,3]thiazolo[3,2-a]indole.
What is the SMILES notation for [1,3]thiazolo[3,2-a]indole?
The canonical SMILES for [1,3]thiazolo[3,2-a]indole is c1ccc2c(c1)cc1sccn12.
What is the InChIKey of [1,3]thiazolo[3,2-a]indole?
The InChIKey is NKEGHPOGONHAJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NS/c1-2-4-9-8(3-1)7-10-11(9)5-6-12-10/h1-7H.
What are the key properties of [1,3]thiazolo[3,2-a]indole?
[1,3]thiazolo[3,2-a]indole has a molecular weight of 173.24 g/mol, XLogP of 3.15, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3]thiazolo[3,2-a]indole is sourced from PubChem (CID 19599422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).