C21H22N2O7S — CID 19599596
2-(4-morpholin-4-ylsulfonylphenyl)-1-(4-nitrophenyl)cyclobutane-1-carboxylic acid (PubChem CID 19599596) has the molecular formula C21H22N2O7S and a molecular weight of 446.48 g/mol. Its IUPAC name is 2-(4-morpholin-4-ylsulfonylphenyl)-1-(4-nitrophenyl)cyclobutane-1-carboxylic acid.
| Compound Name | 2-(4-morpholin-4-ylsulfonylphenyl)-1-(4-nitrophenyl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 19599596 |
| Molecular Formula | C21H22N2O7S |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 2-(4-morpholin-4-ylsulfonylphenyl)-1-(4-nitrophenyl)cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2ccc([N+](=O)[O-])cc2)CCC1c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H22N2O7S/c24-20(25)21(16-3-5-17(6-4-16)23(26)27)10-9-19(21)15-1-7-18(8-2-15)31(28,29)22-11-13-30-14-12-22/h1-8,19H,9-14H2,(H,24,25) |
| InChIKey | UQOZWZLFYYTKDN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|