C22H30N2OS — CID 19599940
1-[2-[(dimethylamino)methyl]-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]-6-phenylhexan-1-one (PubChem CID 19599940) has the molecular formula C22H30N2OS and a molecular weight of 370.56 g/mol. Its IUPAC name is 1-[2-[(dimethylamino)methyl]-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]-6-phenylhexan-1-one.
| Compound Name | 1-[2-[(dimethylamino)methyl]-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]-6-phenylhexan-1-one |
|---|---|
| PubChem CID | 19599940 |
| Molecular Formula | C22H30N2OS |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 1-[2-[(dimethylamino)methyl]-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]-6-phenylhexan-1-one |
| SMILES | CN(C)Cc1cc2c(s1)CN(C(=O)CCCCCc1ccccc1)CC2 |
| InChI | InChI=1S/C22H30N2OS/c1-23(2)16-20-15-19-13-14-24(17-21(19)26-20)22(25)12-8-4-7-11-18-9-5-3-6-10-18/h3,5-6,9-10,15H,4,7-8,11-14,16-17H2,1-2H3 |
| InChIKey | IRZUMGFVMQCQQQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|