C19H23NO2 — CID 19600108
5-(6-phenylhexyl)-6,7-dihydrofuro[3,2-c]pyridin-4-one (PubChem CID 19600108) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 5-(6-phenylhexyl)-6,7-dihydrofuro[3,2-c]pyridin-4-one.
| Compound Name | 5-(6-phenylhexyl)-6,7-dihydrofuro[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 19600108 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 5-(6-phenylhexyl)-6,7-dihydrofuro[3,2-c]pyridin-4-one |
| SMILES | O=C1c2ccoc2CCN1CCCCCCc1ccccc1 |
| InChI | InChI=1S/C19H23NO2/c21-19-17-12-15-22-18(17)11-14-20(19)13-7-2-1-4-8-16-9-5-3-6-10-16/h3,5-6,9-10,12,15H,1-2,4,7-8,11,13-14H2 |
| InChIKey | QVACKHHEVNHJJH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|