About 3-butylsulfanyl-4-iodo-1,2,5-thiadiazole
3-butylsulfanyl-4-iodo-1,2,5-thiadiazole (PubChem CID 19600310) has the molecular formula C6H9IN2S2
and a molecular weight of 300.19 g/mol. Its IUPAC name is 3-butylsulfanyl-4-iodo-1,2,5-thiadiazole.
Molecular Properties
| Compound Name | 3-butylsulfanyl-4-iodo-1,2,5-thiadiazole |
| PubChem CID | 19600310 |
| Molecular Formula | C6H9IN2S2 |
| Molecular Weight | 300.19 g/mol |
| Exact Mass | 299.93 |
| IUPAC Name | 3-butylsulfanyl-4-iodo-1,2,5-thiadiazole |
| SMILES | CCCCSc1nsnc1I |
| InChI | InChI=1S/C6H9IN2S2/c1-2-3-4-10-6-5(7)8-11-9-6/h2-4H2,1H3 |
| InChIKey | DCHIZFDMNPDUTD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.19 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-butylsulfanyl-4-iodo-1,2,5-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butylsulfanyl-4-iodo-1,2,5-thiadiazole?
The IUPAC name of 3-butylsulfanyl-4-iodo-1,2,5-thiadiazole (CID 19600310) is 3-butylsulfanyl-4-iodo-1,2,5-thiadiazole.
What is the SMILES notation for 3-butylsulfanyl-4-iodo-1,2,5-thiadiazole?
The canonical SMILES for 3-butylsulfanyl-4-iodo-1,2,5-thiadiazole is CCCCSc1nsnc1I.
What is the InChIKey of 3-butylsulfanyl-4-iodo-1,2,5-thiadiazole?
The InChIKey is DCHIZFDMNPDUTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9IN2S2/c1-2-3-4-10-6-5(7)8-11-9-6/h2-4H2,1H3.
What are the key properties of 3-butylsulfanyl-4-iodo-1,2,5-thiadiazole?
3-butylsulfanyl-4-iodo-1,2,5-thiadiazole has a molecular weight of 300.19 g/mol, XLogP of 3.03, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butylsulfanyl-4-iodo-1,2,5-thiadiazole is sourced from PubChem (CID 19600310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).