About 3-benzyl-6-hydroxy-2,3-dihydro-1H-quinolin-4-one
3-benzyl-6-hydroxy-2,3-dihydro-1H-quinolin-4-one (PubChem CID 19600633) has the molecular formula C16H15NO2
and a molecular weight of 253.30 g/mol. Its IUPAC name is 3-benzyl-6-hydroxy-2,3-dihydro-1H-quinolin-4-one.
Molecular Properties
| Compound Name | 3-benzyl-6-hydroxy-2,3-dihydro-1H-quinolin-4-one |
| PubChem CID | 19600633 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 3-benzyl-6-hydroxy-2,3-dihydro-1H-quinolin-4-one |
| SMILES | O=C1c2cc(O)ccc2NCC1Cc1ccccc1 |
| InChI | InChI=1S/C16H15NO2/c18-13-6-7-15-14(9-13)16(19)12(10-17-15)8-11-4-2-1-3-5-11/h1-7,9,12,17-18H,8,10H2 |
| InChIKey | UQNPBTHDZVYMHL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-6-hydroxy-2,3-dihydro-1H-quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-6-hydroxy-2,3-dihydro-1H-quinolin-4-one?
The IUPAC name of 3-benzyl-6-hydroxy-2,3-dihydro-1H-quinolin-4-one (CID 19600633) is 3-benzyl-6-hydroxy-2,3-dihydro-1H-quinolin-4-one.
What is the SMILES notation for 3-benzyl-6-hydroxy-2,3-dihydro-1H-quinolin-4-one?
The canonical SMILES for 3-benzyl-6-hydroxy-2,3-dihydro-1H-quinolin-4-one is O=C1c2cc(O)ccc2NCC1Cc1ccccc1.
What is the InChIKey of 3-benzyl-6-hydroxy-2,3-dihydro-1H-quinolin-4-one?
The InChIKey is UQNPBTHDZVYMHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO2/c18-13-6-7-15-14(9-13)16(19)12(10-17-15)8-11-4-2-1-3-5-11/h1-7,9,12,17-18H,8,10H2.
What are the key properties of 3-benzyl-6-hydroxy-2,3-dihydro-1H-quinolin-4-one?
3-benzyl-6-hydroxy-2,3-dihydro-1H-quinolin-4-one has a molecular weight of 253.30 g/mol, XLogP of 2.86, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-6-hydroxy-2,3-dihydro-1H-quinolin-4-one is sourced from PubChem (CID 19600633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).