C21H30N4O — CID 19601566
(E)-N-[3-(1-propylpiperidin-4-yl)-1H-pyrrolo[3,2-b]pyridin-5-yl]hex-3-enamide (PubChem CID 19601566) has the molecular formula C21H30N4O and a molecular weight of 354.50 g/mol. Its IUPAC name is (E)-N-[3-(1-propylpiperidin-4-yl)-1H-pyrrolo[3,2-b]pyridin-5-yl]hex-3-enamide.
| Compound Name | (E)-N-[3-(1-propylpiperidin-4-yl)-1H-pyrrolo[3,2-b]pyridin-5-yl]hex-3-enamide |
|---|---|
| PubChem CID | 19601566 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | (E)-N-[3-(1-propylpiperidin-4-yl)-1H-pyrrolo[3,2-b]pyridin-5-yl]hex-3-enamide |
| SMILES | CC/C=C/CC(=O)Nc1ccc2[nH]cc(C3CCN(CCC)CC3)c2n1 |
| InChI | InChI=1S/C21H30N4O/c1-3-5-6-7-20(26)23-19-9-8-18-21(24-19)17(15-22-18)16-10-13-25(12-4-2)14-11-16/h5-6,8-9,15-16,22H,3-4,7,10-14H2,1-2H3,(H,23,24,26)/b6-5+ |
| InChIKey | WVPIMEHNNYZBBE-AATRIKPKSA-N |
| XLogP | 4.45 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|