About benzimidazole-2-selone
benzimidazole-2-selone (PubChem CID 19602233) has the molecular formula C7H4N2Se
and a molecular weight of 195.08 g/mol. Its IUPAC name is benzimidazole-2-selone.
Molecular Properties
| Compound Name | benzimidazole-2-selone |
| PubChem CID | 19602233 |
| Molecular Formula | C7H4N2Se |
| Molecular Weight | 195.08 g/mol |
| Exact Mass | 195.95 |
| IUPAC Name | benzimidazole-2-selone |
| SMILES | [Se]=C1N=c2ccccc2=N1 |
| InChI | InChI=1S/C7H4N2Se/c10-7-8-5-3-1-2-4-6(5)9-7/h1-4H |
| InChIKey | RCHOHLACSLJTDP-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.08 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze benzimidazole-2-selone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzimidazole-2-selone?
The IUPAC name of benzimidazole-2-selone (CID 19602233) is benzimidazole-2-selone.
What is the SMILES notation for benzimidazole-2-selone?
The canonical SMILES for benzimidazole-2-selone is [Se]=C1N=c2ccccc2=N1.
What is the InChIKey of benzimidazole-2-selone?
The InChIKey is RCHOHLACSLJTDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2Se/c10-7-8-5-3-1-2-4-6(5)9-7/h1-4H.
What are the key properties of benzimidazole-2-selone?
benzimidazole-2-selone has a molecular weight of 195.08 g/mol, XLogP of -0.80, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzimidazole-2-selone is sourced from PubChem (CID 19602233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).