C10H11NO — CID 19603342
1,2,3,4-tetrahydroquinoline-6-carbaldehyde (PubChem CID 19603342) has the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. Its IUPAC name is 1,2,3,4-tetrahydroquinoline-6-carbaldehyde.
| Compound Name | 1,2,3,4-tetrahydroquinoline-6-carbaldehyde |
|---|---|
| PubChem CID | 19603342 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 1,2,3,4-tetrahydroquinoline-6-carbaldehyde |
| SMILES | O=Cc1ccc2c(c1)CCCN2 |
| InChI | InChI=1S/C10H11NO/c12-7-8-3-4-10-9(6-8)2-1-5-11-10/h3-4,6-7,11H,1-2,5H2 |
| InChIKey | SCEYZPPOTANMMP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|