C14H21N3O5 — CID 19603590
N-ethyl-3-methyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2-oxazol-5-amine;oxalic acid (PubChem CID 19603590) has the molecular formula C14H21N3O5 and a molecular weight of 311.34 g/mol. Its IUPAC name is N-ethyl-3-methyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2-oxazol-5-amine;oxalic acid.
| Compound Name | N-ethyl-3-methyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2-oxazol-5-amine;oxalic acid |
|---|---|
| PubChem CID | 19603590 |
| Molecular Formula | C14H21N3O5 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | N-ethyl-3-methyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2-oxazol-5-amine;oxalic acid |
| SMILES | CCNc1onc(C)c1C1=CCCN(C)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C12H19N3O.C2H2O4/c1-4-13-12-11(9(2)14-16-12)10-6-5-7-15(3)8-10;3-1(4)2(5)6/h6,13H,4-5,7-8H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | GYFCNZFFXAVCLI-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 115.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|