C17H27N3O5 — CID 19603626
4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-N,N-dipropyl-1,2-oxazol-5-amine;oxalic acid (PubChem CID 19603626) has the molecular formula C17H27N3O5 and a molecular weight of 353.42 g/mol. Its IUPAC name is 4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-N,N-dipropyl-1,2-oxazol-5-amine;oxalic acid.
| Compound Name | 4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-N,N-dipropyl-1,2-oxazol-5-amine;oxalic acid |
|---|---|
| PubChem CID | 19603626 |
| Molecular Formula | C17H27N3O5 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-N,N-dipropyl-1,2-oxazol-5-amine;oxalic acid |
| SMILES | CCCN(CCC)c1oncc1C1=CCCN(C)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H25N3O.C2H2O4/c1-4-8-18(9-5-2)15-14(11-16-19-15)13-7-6-10-17(3)12-13;3-1(4)2(5)6/h7,11H,4-6,8-10,12H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | LFBNYDWWNOHVOH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|