C31H32N2O6S — CID 19603706
4-[1-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]-3-(carboxymethyl)-2-methylindol-5-yl]oxybutanoic acid (PubChem CID 19603706) has the molecular formula C31H32N2O6S and a molecular weight of 560.67 g/mol. Its IUPAC name is 4-[1-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]-3-(carboxymethyl)-2-methylindol-5-yl]oxybutanoic acid.
| Compound Name | 4-[1-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]-3-(carboxymethyl)-2-methylindol-5-yl]oxybutanoic acid |
|---|---|
| PubChem CID | 19603706 |
| Molecular Formula | C31H32N2O6S |
| Molecular Weight | 560.67 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | 4-[1-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]-3-(carboxymethyl)-2-methylindol-5-yl]oxybutanoic acid |
| SMILES | Cc1c(CC(=O)O)c2cc(OCCCC(=O)O)ccc2n1Cc1ccc2oc(-c3nc(C(C)(C)C)cs3)cc2c1 |
| InChI | InChI=1S/C31H32N2O6S/c1-18-22(15-29(36)37)23-14-21(38-11-5-6-28(34)35)8-9-24(23)33(18)16-19-7-10-25-20(12-19)13-26(39-25)30-32-27(17-40-30)31(2,3)4/h7-10,12-14,17H,5-6,11,15-16H2,1-4H3,(H,34,35)(H,36,37) |
| InChIKey | GEWOBHWYVOSITA-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 114.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.67 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|