C11H20N2 — CID 19604005
1,3-dibutylpyrazole (PubChem CID 19604005) has the molecular formula C11H20N2 and a molecular weight of 180.30 g/mol. Its IUPAC name is 1,3-dibutylpyrazole.
| Compound Name | 1,3-dibutylpyrazole |
|---|---|
| PubChem CID | 19604005 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.30 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 1,3-dibutylpyrazole |
| SMILES | CCCCc1ccn(CCCC)n1 |
| InChI | InChI=1S/C11H20N2/c1-3-5-7-11-8-10-13(12-11)9-6-4-2/h8,10H,3-7,9H2,1-2H3 |
| InChIKey | JVYFJYPLZZBDDU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |