About 1,3-dibutylpyrazole
1,3-dibutylpyrazole (PubChem CID 19604005) has the molecular formula C11H20N2
and a molecular weight of 180.30 g/mol. Its IUPAC name is 1,3-dibutylpyrazole.
Molecular Properties
| Compound Name | 1,3-dibutylpyrazole |
| PubChem CID | 19604005 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.30 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 1,3-dibutylpyrazole |
| SMILES | CCCCc1ccn(CCCC)n1 |
| InChI | InChI=1S/C11H20N2/c1-3-5-7-11-8-10-13(12-11)9-6-4-2/h8,10H,3-7,9H2,1-2H3 |
| InChIKey | JVYFJYPLZZBDDU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-dibutylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dibutylpyrazole?
The IUPAC name of 1,3-dibutylpyrazole (CID 19604005) is 1,3-dibutylpyrazole.
What is the SMILES notation for 1,3-dibutylpyrazole?
The canonical SMILES for 1,3-dibutylpyrazole is CCCCc1ccn(CCCC)n1.
What is the InChIKey of 1,3-dibutylpyrazole?
The InChIKey is JVYFJYPLZZBDDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2/c1-3-5-7-11-8-10-13(12-11)9-6-4-2/h8,10H,3-7,9H2,1-2H3.
What are the key properties of 1,3-dibutylpyrazole?
1,3-dibutylpyrazole has a molecular weight of 180.30 g/mol, XLogP of 3.03, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dibutylpyrazole is sourced from PubChem (CID 19604005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).