About 2,2-dibutylmorpholine
2,2-dibutylmorpholine (PubChem CID 19604010) has the molecular formula C12H25NO
and a molecular weight of 199.34 g/mol. Its IUPAC name is 2,2-dibutylmorpholine.
Molecular Properties
| Compound Name | 2,2-dibutylmorpholine |
| PubChem CID | 19604010 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 2,2-dibutylmorpholine |
| SMILES | CCCCC1(CCCC)CNCCO1 |
| InChI | InChI=1S/C12H25NO/c1-3-5-7-12(8-6-4-2)11-13-9-10-14-12/h13H,3-11H2,1-2H3 |
| InChIKey | CXAMIBZRTIZSAV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-dibutylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dibutylmorpholine?
The IUPAC name of 2,2-dibutylmorpholine (CID 19604010) is 2,2-dibutylmorpholine.
What is the SMILES notation for 2,2-dibutylmorpholine?
The canonical SMILES for 2,2-dibutylmorpholine is CCCCC1(CCCC)CNCCO1.
What is the InChIKey of 2,2-dibutylmorpholine?
The InChIKey is CXAMIBZRTIZSAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO/c1-3-5-7-12(8-6-4-2)11-13-9-10-14-12/h13H,3-11H2,1-2H3.
What are the key properties of 2,2-dibutylmorpholine?
2,2-dibutylmorpholine has a molecular weight of 199.34 g/mol, XLogP of 2.73, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dibutylmorpholine is sourced from PubChem (CID 19604010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).