About 2,5-dipropyl-3,4-dihydropyrazole
2,5-dipropyl-3,4-dihydropyrazole (PubChem CID 19604040) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is 2,5-dipropyl-3,4-dihydropyrazole.
Molecular Properties
| Compound Name | 2,5-dipropyl-3,4-dihydropyrazole |
| PubChem CID | 19604040 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 2,5-dipropyl-3,4-dihydropyrazole |
| SMILES | CCCC1=NN(CCC)CC1 |
| InChI | InChI=1S/C9H18N2/c1-3-5-9-6-8-11(10-9)7-4-2/h3-8H2,1-2H3 |
| InChIKey | KKEPCOFCMBPEPX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-dipropyl-3,4-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dipropyl-3,4-dihydropyrazole?
The IUPAC name of 2,5-dipropyl-3,4-dihydropyrazole (CID 19604040) is 2,5-dipropyl-3,4-dihydropyrazole.
What is the SMILES notation for 2,5-dipropyl-3,4-dihydropyrazole?
The canonical SMILES for 2,5-dipropyl-3,4-dihydropyrazole is CCCC1=NN(CCC)CC1.
What is the InChIKey of 2,5-dipropyl-3,4-dihydropyrazole?
The InChIKey is KKEPCOFCMBPEPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2/c1-3-5-9-6-8-11(10-9)7-4-2/h3-8H2,1-2H3.
What are the key properties of 2,5-dipropyl-3,4-dihydropyrazole?
2,5-dipropyl-3,4-dihydropyrazole has a molecular weight of 154.26 g/mol, XLogP of 2.26, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dipropyl-3,4-dihydropyrazole is sourced from PubChem (CID 19604040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).