C16H27N2+ — CID 19604703
1,1,2,2-tetrakis(prop-2-enyl)piperazin-1-ium (PubChem CID 19604703) has the molecular formula C16H27N2+ and a molecular weight of 247.41 g/mol. Its IUPAC name is 1,1,2,2-tetrakis(prop-2-enyl)piperazin-1-ium.
| Compound Name | 1,1,2,2-tetrakis(prop-2-enyl)piperazin-1-ium |
|---|---|
| PubChem CID | 19604703 |
| Molecular Formula | C16H27N2+ |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.22 |
| IUPAC Name | 1,1,2,2-tetrakis(prop-2-enyl)piperazin-1-ium |
| SMILES | C=CCC1(CC=C)CNCC[N+]1(CC=C)CC=C |
| InChI | InChI=1S/C16H27N2/c1-5-9-16(10-6-2)15-17-11-14-18(16,12-7-3)13-8-4/h5-8,17H,1-4,9-15H2/q+1 |
| InChIKey | GQFPBLOMOOZVKV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|