About 2-imidazo[5,1-b][1,3]thiazol-3-ylethanol
2-imidazo[5,1-b][1,3]thiazol-3-ylethanol (PubChem CID 19605055) has the molecular formula C7H8N2OS
and a molecular weight of 168.22 g/mol. Its IUPAC name is 2-imidazo[5,1-b][1,3]thiazol-3-ylethanol.
Molecular Properties
| Compound Name | 2-imidazo[5,1-b][1,3]thiazol-3-ylethanol |
| PubChem CID | 19605055 |
| Molecular Formula | C7H8N2OS |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | 2-imidazo[5,1-b][1,3]thiazol-3-ylethanol |
| SMILES | OCCc1csc2cncn12 |
| InChI | InChI=1S/C7H8N2OS/c10-2-1-6-4-11-7-3-8-5-9(6)7/h3-5,10H,1-2H2 |
| InChIKey | OSQUSJHMCLIDTP-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-imidazo[5,1-b][1,3]thiazol-3-ylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imidazo[5,1-b][1,3]thiazol-3-ylethanol?
The IUPAC name of 2-imidazo[5,1-b][1,3]thiazol-3-ylethanol (CID 19605055) is 2-imidazo[5,1-b][1,3]thiazol-3-ylethanol.
What is the SMILES notation for 2-imidazo[5,1-b][1,3]thiazol-3-ylethanol?
The canonical SMILES for 2-imidazo[5,1-b][1,3]thiazol-3-ylethanol is OCCc1csc2cncn12.
What is the InChIKey of 2-imidazo[5,1-b][1,3]thiazol-3-ylethanol?
The InChIKey is OSQUSJHMCLIDTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2OS/c10-2-1-6-4-11-7-3-8-5-9(6)7/h3-5,10H,1-2H2.
What are the key properties of 2-imidazo[5,1-b][1,3]thiazol-3-ylethanol?
2-imidazo[5,1-b][1,3]thiazol-3-ylethanol has a molecular weight of 168.22 g/mol, XLogP of 0.93, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imidazo[5,1-b][1,3]thiazol-3-ylethanol is sourced from PubChem (CID 19605055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).