About N-[(2-methylimidazo[5,1-b][1,3]thiazol-3-yl)methyl]formamide
N-[(2-methylimidazo[5,1-b][1,3]thiazol-3-yl)methyl]formamide (PubChem CID 19605204) has the molecular formula C8H9N3OS
and a molecular weight of 195.25 g/mol. Its IUPAC name is N-[(2-methylimidazo[5,1-b][1,3]thiazol-3-yl)methyl]formamide.
Molecular Properties
| Compound Name | N-[(2-methylimidazo[5,1-b][1,3]thiazol-3-yl)methyl]formamide |
| PubChem CID | 19605204 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | N-[(2-methylimidazo[5,1-b][1,3]thiazol-3-yl)methyl]formamide |
| SMILES | Cc1sc2cncn2c1CNC=O |
| InChI | InChI=1S/C8H9N3OS/c1-6-7(2-10-5-12)11-4-9-3-8(11)13-6/h3-5H,2H2,1H3,(H,10,12) |
| InChIKey | ZFGXKPZPVKXSIC-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[(2-methylimidazo[5,1-b][1,3]thiazol-3-yl)methyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-methylimidazo[5,1-b][1,3]thiazol-3-yl)methyl]formamide?
The IUPAC name of N-[(2-methylimidazo[5,1-b][1,3]thiazol-3-yl)methyl]formamide (CID 19605204) is N-[(2-methylimidazo[5,1-b][1,3]thiazol-3-yl)methyl]formamide.
What is the SMILES notation for N-[(2-methylimidazo[5,1-b][1,3]thiazol-3-yl)methyl]formamide?
The canonical SMILES for N-[(2-methylimidazo[5,1-b][1,3]thiazol-3-yl)methyl]formamide is Cc1sc2cncn2c1CNC=O.
What is the InChIKey of N-[(2-methylimidazo[5,1-b][1,3]thiazol-3-yl)methyl]formamide?
The InChIKey is ZFGXKPZPVKXSIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3OS/c1-6-7(2-10-5-12)11-4-9-3-8(11)13-6/h3-5H,2H2,1H3,(H,10,12).
What are the key properties of N-[(2-methylimidazo[5,1-b][1,3]thiazol-3-yl)methyl]formamide?
N-[(2-methylimidazo[5,1-b][1,3]thiazol-3-yl)methyl]formamide has a molecular weight of 195.25 g/mol, XLogP of 0.95, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-methylimidazo[5,1-b][1,3]thiazol-3-yl)methyl]formamide is sourced from PubChem (CID 19605204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).