About imidazo[5,1-b][1,3]thiazole-2-carboxamide
imidazo[5,1-b][1,3]thiazole-2-carboxamide (PubChem CID 19605222) has the molecular formula C6H5N3OS
and a molecular weight of 167.19 g/mol. Its IUPAC name is imidazo[5,1-b][1,3]thiazole-2-carboxamide.
Molecular Properties
| Compound Name | imidazo[5,1-b][1,3]thiazole-2-carboxamide |
| PubChem CID | 19605222 |
| Molecular Formula | C6H5N3OS |
| Molecular Weight | 167.19 g/mol |
| Exact Mass | 167.02 |
| IUPAC Name | imidazo[5,1-b][1,3]thiazole-2-carboxamide |
| SMILES | NC(=O)c1cn2cncc2s1 |
| InChI | InChI=1S/C6H5N3OS/c7-6(10)4-2-9-3-8-1-5(9)11-4/h1-3H,(H2,7,10) |
| InChIKey | ZMERUTVFYFRULX-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.19 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze imidazo[5,1-b][1,3]thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[5,1-b][1,3]thiazole-2-carboxamide?
The IUPAC name of imidazo[5,1-b][1,3]thiazole-2-carboxamide (CID 19605222) is imidazo[5,1-b][1,3]thiazole-2-carboxamide.
What is the SMILES notation for imidazo[5,1-b][1,3]thiazole-2-carboxamide?
The canonical SMILES for imidazo[5,1-b][1,3]thiazole-2-carboxamide is NC(=O)c1cn2cncc2s1.
What is the InChIKey of imidazo[5,1-b][1,3]thiazole-2-carboxamide?
The InChIKey is ZMERUTVFYFRULX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3OS/c7-6(10)4-2-9-3-8-1-5(9)11-4/h1-3H,(H2,7,10).
What are the key properties of imidazo[5,1-b][1,3]thiazole-2-carboxamide?
imidazo[5,1-b][1,3]thiazole-2-carboxamide has a molecular weight of 167.19 g/mol, XLogP of 0.49, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[5,1-b][1,3]thiazole-2-carboxamide is sourced from PubChem (CID 19605222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).