C21H23N7 — CID 19605714
N-(2,6-dimethylphenyl)-12-piperazin-1-yl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-amine (PubChem CID 19605714) has the molecular formula C21H23N7 and a molecular weight of 373.46 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-12-piperazin-1-yl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-amine.
| Compound Name | N-(2,6-dimethylphenyl)-12-piperazin-1-yl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-amine |
|---|---|
| PubChem CID | 19605714 |
| Molecular Formula | C21H23N7 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | N-(2,6-dimethylphenyl)-12-piperazin-1-yl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-amine |
| SMILES | Cc1cccc(C)c1Nc1nc2ccc(N3CCNCC3)nc2n2cncc12 |
| InChI | InChI=1S/C21H23N7/c1-14-4-3-5-15(2)19(14)26-20-17-12-23-13-28(17)21-16(24-20)6-7-18(25-21)27-10-8-22-9-11-27/h3-7,12-13,22H,8-11H2,1-2H3,(H,24,26) |
| InChIKey | AVAKRECUWUXYED-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |