About N-[[9,9-bis[(2-fluoro-4-pyridinyl)methyl]fluoren-2-yl]methyl]-N-methylacetamide
N-[[9,9-bis[(2-fluoro-4-pyridinyl)methyl]fluoren-2-yl]methyl]-N-methylacetamide (PubChem CID 19606070) has the molecular formula C29H25F2N3O
and a molecular weight of 469.54 g/mol. Its IUPAC name is N-[[9,9-bis[(2-fluoro-4-pyridinyl)methyl]fluoren-2-yl]methyl]-N-methylacetamide.
Molecular Properties
| Compound Name | N-[[9,9-bis[(2-fluoro-4-pyridinyl)methyl]fluoren-2-yl]methyl]-N-methylacetamide |
| PubChem CID | 19606070 |
| Molecular Formula | C29H25F2N3O |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | N-[[9,9-bis[(2-fluoro-4-pyridinyl)methyl]fluoren-2-yl]methyl]-N-methylacetamide |
| SMILES | CC(=O)N(C)Cc1ccc2c(c1)C(Cc1ccnc(F)c1)(Cc1ccnc(F)c1)c1ccccc1-2 |
| InChI | InChI=1S/C29H25F2N3O/c1-19(35)34(2)18-22-7-8-24-23-5-3-4-6-25(23)29(26(24)13-22,16-20-9-11-32-27(30)14-20)17-21-10-12-33-28(31)15-21/h3-15H,16-18H2,1-2H3 |
| InChIKey | WATCAMZEYAAGOM-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-[[9,9-bis[(2-fluoro-4-pyridinyl)methyl]fluoren-2-yl]methyl]-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[9,9-bis[(2-fluoro-4-pyridinyl)methyl]fluoren-2-yl]methyl]-N-methylacetamide?
The IUPAC name of N-[[9,9-bis[(2-fluoro-4-pyridinyl)methyl]fluoren-2-yl]methyl]-N-methylacetamide (CID 19606070) is N-[[9,9-bis[(2-fluoro-4-pyridinyl)methyl]fluoren-2-yl]methyl]-N-methylacetamide.
What is the SMILES notation for N-[[9,9-bis[(2-fluoro-4-pyridinyl)methyl]fluoren-2-yl]methyl]-N-methylacetamide?
The canonical SMILES for N-[[9,9-bis[(2-fluoro-4-pyridinyl)methyl]fluoren-2-yl]methyl]-N-methylacetamide is CC(=O)N(C)Cc1ccc2c(c1)C(Cc1ccnc(F)c1)(Cc1ccnc(F)c1)c1ccccc1-2.
What is the InChIKey of N-[[9,9-bis[(2-fluoro-4-pyridinyl)methyl]fluoren-2-yl]methyl]-N-methylacetamide?
The InChIKey is WATCAMZEYAAGOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H25F2N3O/c1-19(35)34(2)18-22-7-8-24-23-5-3-4-6-25(23)29(26(24)13-22,16-20-9-11-32-27(30)14-20)17-21-10-12-33-28(31)15-21/h3-15H,16-18H2,1-2H3.
What are the key properties of N-[[9,9-bis[(2-fluoro-4-pyridinyl)methyl]fluoren-2-yl]methyl]-N-methylacetamide?
N-[[9,9-bis[(2-fluoro-4-pyridinyl)methyl]fluoren-2-yl]methyl]-N-methylacetamide has a molecular weight of 469.54 g/mol, XLogP of 5.49, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[9,9-bis[(2-fluoro-4-pyridinyl)methyl]fluoren-2-yl]methyl]-N-methylacetamide is sourced from PubChem (CID 19606070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).