About 1-[9,9-bis[(2-fluoro-4-pyridinyl)methyl]fluoren-2-yl]-N-methylmethanamine
1-[9,9-bis[(2-fluoro-4-pyridinyl)methyl]fluoren-2-yl]-N-methylmethanamine (PubChem CID 19606078) has the molecular formula C27H23F2N3
and a molecular weight of 427.50 g/mol. Its IUPAC name is 1-[9,9-bis[(2-fluoro-4-pyridinyl)methyl]fluoren-2-yl]-N-methylmethanamine.
Molecular Properties
| Compound Name | 1-[9,9-bis[(2-fluoro-4-pyridinyl)methyl]fluoren-2-yl]-N-methylmethanamine |
| PubChem CID | 19606078 |
| Molecular Formula | C27H23F2N3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 1-[9,9-bis[(2-fluoro-4-pyridinyl)methyl]fluoren-2-yl]-N-methylmethanamine |
| SMILES | CNCc1ccc2c(c1)C(Cc1ccnc(F)c1)(Cc1ccnc(F)c1)c1ccccc1-2 |
| InChI | InChI=1S/C27H23F2N3/c1-30-17-20-6-7-22-21-4-2-3-5-23(21)27(24(22)12-20,15-18-8-10-31-25(28)13-18)16-19-9-11-32-26(29)14-19/h2-14,30H,15-17H2,1H3 |
| InChIKey | OWKSVJYAIDCIGC-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-[9,9-bis[(2-fluoro-4-pyridinyl)methyl]fluoren-2-yl]-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[9,9-bis[(2-fluoro-4-pyridinyl)methyl]fluoren-2-yl]-N-methylmethanamine?
The IUPAC name of 1-[9,9-bis[(2-fluoro-4-pyridinyl)methyl]fluoren-2-yl]-N-methylmethanamine (CID 19606078) is 1-[9,9-bis[(2-fluoro-4-pyridinyl)methyl]fluoren-2-yl]-N-methylmethanamine.
What is the SMILES notation for 1-[9,9-bis[(2-fluoro-4-pyridinyl)methyl]fluoren-2-yl]-N-methylmethanamine?
The canonical SMILES for 1-[9,9-bis[(2-fluoro-4-pyridinyl)methyl]fluoren-2-yl]-N-methylmethanamine is CNCc1ccc2c(c1)C(Cc1ccnc(F)c1)(Cc1ccnc(F)c1)c1ccccc1-2.
What is the InChIKey of 1-[9,9-bis[(2-fluoro-4-pyridinyl)methyl]fluoren-2-yl]-N-methylmethanamine?
The InChIKey is OWKSVJYAIDCIGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H23F2N3/c1-30-17-20-6-7-22-21-4-2-3-5-23(21)27(24(22)12-20,15-18-8-10-31-25(28)13-18)16-19-9-11-32-26(29)14-19/h2-14,30H,15-17H2,1H3.
What are the key properties of 1-[9,9-bis[(2-fluoro-4-pyridinyl)methyl]fluoren-2-yl]-N-methylmethanamine?
1-[9,9-bis[(2-fluoro-4-pyridinyl)methyl]fluoren-2-yl]-N-methylmethanamine has a molecular weight of 427.50 g/mol, XLogP of 5.23, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[9,9-bis[(2-fluoro-4-pyridinyl)methyl]fluoren-2-yl]-N-methylmethanamine is sourced from PubChem (CID 19606078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).