About 5,5-bis[(2-fluoro-4-pyridinyl)methyl]-7-iodoindeno[1,2-b]pyridine
5,5-bis[(2-fluoro-4-pyridinyl)methyl]-7-iodoindeno[1,2-b]pyridine (PubChem CID 19606096) has the molecular formula C24H16F2IN3
and a molecular weight of 511.31 g/mol. Its IUPAC name is 5,5-bis[(2-fluoro-4-pyridinyl)methyl]-7-iodoindeno[1,2-b]pyridine.
Molecular Properties
| Compound Name | 5,5-bis[(2-fluoro-4-pyridinyl)methyl]-7-iodoindeno[1,2-b]pyridine |
| PubChem CID | 19606096 |
| Molecular Formula | C24H16F2IN3 |
| Molecular Weight | 511.31 g/mol |
| Exact Mass | 511.04 |
| IUPAC Name | 5,5-bis[(2-fluoro-4-pyridinyl)methyl]-7-iodoindeno[1,2-b]pyridine |
| SMILES | Fc1cc(CC2(Cc3ccnc(F)c3)c3cc(I)ccc3-c3ncccc32)ccn1 |
| InChI | InChI=1S/C24H16F2IN3/c25-21-10-15(5-8-28-21)13-24(14-16-6-9-29-22(26)11-16)19-2-1-7-30-23(19)18-4-3-17(27)12-20(18)24/h1-12H,13-14H2 |
| InChIKey | LJVFSEFVAHSXGL-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 511.31 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5,5-bis[(2-fluoro-4-pyridinyl)methyl]-7-iodoindeno[1,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-bis[(2-fluoro-4-pyridinyl)methyl]-7-iodoindeno[1,2-b]pyridine?
The IUPAC name of 5,5-bis[(2-fluoro-4-pyridinyl)methyl]-7-iodoindeno[1,2-b]pyridine (CID 19606096) is 5,5-bis[(2-fluoro-4-pyridinyl)methyl]-7-iodoindeno[1,2-b]pyridine.
What is the SMILES notation for 5,5-bis[(2-fluoro-4-pyridinyl)methyl]-7-iodoindeno[1,2-b]pyridine?
The canonical SMILES for 5,5-bis[(2-fluoro-4-pyridinyl)methyl]-7-iodoindeno[1,2-b]pyridine is Fc1cc(CC2(Cc3ccnc(F)c3)c3cc(I)ccc3-c3ncccc32)ccn1.
What is the InChIKey of 5,5-bis[(2-fluoro-4-pyridinyl)methyl]-7-iodoindeno[1,2-b]pyridine?
The InChIKey is LJVFSEFVAHSXGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H16F2IN3/c25-21-10-15(5-8-28-21)13-24(14-16-6-9-29-22(26)11-16)19-2-1-7-30-23(19)18-4-3-17(27)12-20(18)24/h1-12H,13-14H2.
What are the key properties of 5,5-bis[(2-fluoro-4-pyridinyl)methyl]-7-iodoindeno[1,2-b]pyridine?
5,5-bis[(2-fluoro-4-pyridinyl)methyl]-7-iodoindeno[1,2-b]pyridine has a molecular weight of 511.31 g/mol, XLogP of 5.51, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-bis[(2-fluoro-4-pyridinyl)methyl]-7-iodoindeno[1,2-b]pyridine is sourced from PubChem (CID 19606096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).