About 5,5-bis[(2-fluoro-4-pyridinyl)methyl]-7-methoxychromeno[2,3-b]pyridine
5,5-bis[(2-fluoro-4-pyridinyl)methyl]-7-methoxychromeno[2,3-b]pyridine (PubChem CID 19606107) has the molecular formula C25H19F2N3O2
and a molecular weight of 431.44 g/mol. Its IUPAC name is 5,5-bis[(2-fluoro-4-pyridinyl)methyl]-7-methoxychromeno[2,3-b]pyridine.
Molecular Properties
| Compound Name | 5,5-bis[(2-fluoro-4-pyridinyl)methyl]-7-methoxychromeno[2,3-b]pyridine |
| PubChem CID | 19606107 |
| Molecular Formula | C25H19F2N3O2 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 5,5-bis[(2-fluoro-4-pyridinyl)methyl]-7-methoxychromeno[2,3-b]pyridine |
| SMILES | COc1ccc2c(c1)C(Cc1ccnc(F)c1)(Cc1ccnc(F)c1)c1cccnc1O2 |
| InChI | InChI=1S/C25H19F2N3O2/c1-31-18-4-5-21-20(13-18)25(14-16-6-9-28-22(26)11-16,15-17-7-10-29-23(27)12-17)19-3-2-8-30-24(19)32-21/h2-13H,14-15H2,1H3 |
| InChIKey | VCDFCSBEUGGPQE-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5,5-bis[(2-fluoro-4-pyridinyl)methyl]-7-methoxychromeno[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-bis[(2-fluoro-4-pyridinyl)methyl]-7-methoxychromeno[2,3-b]pyridine?
The IUPAC name of 5,5-bis[(2-fluoro-4-pyridinyl)methyl]-7-methoxychromeno[2,3-b]pyridine (CID 19606107) is 5,5-bis[(2-fluoro-4-pyridinyl)methyl]-7-methoxychromeno[2,3-b]pyridine.
What is the SMILES notation for 5,5-bis[(2-fluoro-4-pyridinyl)methyl]-7-methoxychromeno[2,3-b]pyridine?
The canonical SMILES for 5,5-bis[(2-fluoro-4-pyridinyl)methyl]-7-methoxychromeno[2,3-b]pyridine is COc1ccc2c(c1)C(Cc1ccnc(F)c1)(Cc1ccnc(F)c1)c1cccnc1O2.
What is the InChIKey of 5,5-bis[(2-fluoro-4-pyridinyl)methyl]-7-methoxychromeno[2,3-b]pyridine?
The InChIKey is VCDFCSBEUGGPQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H19F2N3O2/c1-31-18-4-5-21-20(13-18)25(14-16-6-9-28-22(26)11-16,15-17-7-10-29-23(27)12-17)19-3-2-8-30-24(19)32-21/h2-13H,14-15H2,1H3.
What are the key properties of 5,5-bis[(2-fluoro-4-pyridinyl)methyl]-7-methoxychromeno[2,3-b]pyridine?
5,5-bis[(2-fluoro-4-pyridinyl)methyl]-7-methoxychromeno[2,3-b]pyridine has a molecular weight of 431.44 g/mol, XLogP of 5.04, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-bis[(2-fluoro-4-pyridinyl)methyl]-7-methoxychromeno[2,3-b]pyridine is sourced from PubChem (CID 19606107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).