C28H31ClN4O2 — CID 19608160
N-[4-[7-chloro-5-(methylamino)-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl]phenyl]-N'-ethyl-N'-phenylacetohydrazide (PubChem CID 19608160) has the molecular formula C28H31ClN4O2 and a molecular weight of 491.04 g/mol. Its IUPAC name is N-[4-[7-chloro-5-(methylamino)-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl]phenyl]-N'-ethyl-N'-phenylacetohydrazide.
| Compound Name | N-[4-[7-chloro-5-(methylamino)-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl]phenyl]-N'-ethyl-N'-phenylacetohydrazide |
|---|---|
| PubChem CID | 19608160 |
| Molecular Formula | C28H31ClN4O2 |
| Molecular Weight | 491.04 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | N-[4-[7-chloro-5-(methylamino)-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl]phenyl]-N'-ethyl-N'-phenylacetohydrazide |
| SMILES | CCN(c1ccccc1)N(C(C)=O)c1ccc(C(=O)N2CCCC(NC)c3cc(Cl)ccc32)cc1 |
| InChI | InChI=1S/C28H31ClN4O2/c1-4-32(23-9-6-5-7-10-23)33(20(2)34)24-15-12-21(13-16-24)28(35)31-18-8-11-26(30-3)25-19-22(29)14-17-27(25)31/h5-7,9-10,12-17,19,26,30H,4,8,11,18H2,1-3H3 |
| InChIKey | AMRAWPKEKQTMNS-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.04 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|