About 2-piperazin-1-ylpropanal
2-piperazin-1-ylpropanal (PubChem CID 19608631) has the molecular formula C7H14N2O
and a molecular weight of 142.20 g/mol. Its IUPAC name is 2-piperazin-1-ylpropanal.
Molecular Properties
| Compound Name | 2-piperazin-1-ylpropanal |
| PubChem CID | 19608631 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 2-piperazin-1-ylpropanal |
| SMILES | CC(C=O)N1CCNCC1 |
| InChI | InChI=1S/C7H14N2O/c1-7(6-10)9-4-2-8-3-5-9/h6-8H,2-5H2,1H3 |
| InChIKey | NRPARTHTHRTTMK-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-piperazin-1-ylpropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperazin-1-ylpropanal?
The IUPAC name of 2-piperazin-1-ylpropanal (CID 19608631) is 2-piperazin-1-ylpropanal.
What is the SMILES notation for 2-piperazin-1-ylpropanal?
The canonical SMILES for 2-piperazin-1-ylpropanal is CC(C=O)N1CCNCC1.
What is the InChIKey of 2-piperazin-1-ylpropanal?
The InChIKey is NRPARTHTHRTTMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O/c1-7(6-10)9-4-2-8-3-5-9/h6-8H,2-5H2,1H3.
What are the key properties of 2-piperazin-1-ylpropanal?
2-piperazin-1-ylpropanal has a molecular weight of 142.20 g/mol, XLogP of -0.52, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperazin-1-ylpropanal is sourced from PubChem (CID 19608631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).