About 3',6'-dihydroxy-4'-(piperazin-1-ylmethyl)spiro[2-benzofuran-3,9'-xanthene]-1-one
3',6'-dihydroxy-4'-(piperazin-1-ylmethyl)spiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 19609090) has the molecular formula C25H22N2O5
and a molecular weight of 430.46 g/mol. Its IUPAC name is 3',6'-dihydroxy-4'-(piperazin-1-ylmethyl)spiro[2-benzofuran-3,9'-xanthene]-1-one.
Molecular Properties
| Compound Name | 3',6'-dihydroxy-4'-(piperazin-1-ylmethyl)spiro[2-benzofuran-3,9'-xanthene]-1-one |
| PubChem CID | 19609090 |
| Molecular Formula | C25H22N2O5 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 3',6'-dihydroxy-4'-(piperazin-1-ylmethyl)spiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | O=C1OC2(c3ccc(O)cc3Oc3c2ccc(O)c3CN2CCNCC2)c2ccccc21 |
| InChI | InChI=1S/C25H22N2O5/c28-15-5-6-19-22(13-15)31-23-17(14-27-11-9-26-10-12-27)21(29)8-7-20(23)25(19)18-4-2-1-3-16(18)24(30)32-25/h1-8,13,26,28-29H,9-12,14H2 |
| InChIKey | MBKLLEZRKJBRGT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 3',6'-dihydroxy-4'-(piperazin-1-ylmethyl)spiro[2-benzofuran-3,9'-xanthene]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3',6'-dihydroxy-4'-(piperazin-1-ylmethyl)spiro[2-benzofuran-3,9'-xanthene]-1-one?
The IUPAC name of 3',6'-dihydroxy-4'-(piperazin-1-ylmethyl)spiro[2-benzofuran-3,9'-xanthene]-1-one (CID 19609090) is 3',6'-dihydroxy-4'-(piperazin-1-ylmethyl)spiro[2-benzofuran-3,9'-xanthene]-1-one.
What is the SMILES notation for 3',6'-dihydroxy-4'-(piperazin-1-ylmethyl)spiro[2-benzofuran-3,9'-xanthene]-1-one?
The canonical SMILES for 3',6'-dihydroxy-4'-(piperazin-1-ylmethyl)spiro[2-benzofuran-3,9'-xanthene]-1-one is O=C1OC2(c3ccc(O)cc3Oc3c2ccc(O)c3CN2CCNCC2)c2ccccc21.
What is the InChIKey of 3',6'-dihydroxy-4'-(piperazin-1-ylmethyl)spiro[2-benzofuran-3,9'-xanthene]-1-one?
The InChIKey is MBKLLEZRKJBRGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22N2O5/c28-15-5-6-19-22(13-15)31-23-17(14-27-11-9-26-10-12-27)21(29)8-7-20(23)25(19)18-4-2-1-3-16(18)24(30)32-25/h1-8,13,26,28-29H,9-12,14H2.
What are the key properties of 3',6'-dihydroxy-4'-(piperazin-1-ylmethyl)spiro[2-benzofuran-3,9'-xanthene]-1-one?
3',6'-dihydroxy-4'-(piperazin-1-ylmethyl)spiro[2-benzofuran-3,9'-xanthene]-1-one has a molecular weight of 430.46 g/mol, XLogP of 3.07, 2 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3',6'-dihydroxy-4'-(piperazin-1-ylmethyl)spiro[2-benzofuran-3,9'-xanthene]-1-one is sourced from PubChem (CID 19609090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).