C18H40N3OP — CID 19609101
N-[diethylamino-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxyphosphanyl]-N-ethylethanamine (PubChem CID 19609101) has the molecular formula C18H40N3OP and a molecular weight of 345.51 g/mol. Its IUPAC name is N-[diethylamino-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxyphosphanyl]-N-ethylethanamine.
| Compound Name | N-[diethylamino-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxyphosphanyl]-N-ethylethanamine |
|---|---|
| PubChem CID | 19609101 |
| Molecular Formula | C18H40N3OP |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.29 |
| IUPAC Name | N-[diethylamino-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxyphosphanyl]-N-ethylethanamine |
| SMILES | CCN(CC)P(OC1CC(C)(C)N(C)C(C)(C)C1)N(CC)CC |
| InChI | InChI=1S/C18H40N3OP/c1-10-20(11-2)23(21(12-3)13-4)22-16-14-17(5,6)19(9)18(7,8)15-16/h16H,10-15H2,1-9H3 |
| InChIKey | HMKVXZHUKUOSEC-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|