C10H23N3 — CID 19609586
1-(2,2-dimethylpiperidin-4-yl)-1,2,2-trimethylhydrazine (PubChem CID 19609586) has the molecular formula C10H23N3 and a molecular weight of 185.31 g/mol. Its IUPAC name is 1-(2,2-dimethylpiperidin-4-yl)-1,2,2-trimethylhydrazine.
| Compound Name | 1-(2,2-dimethylpiperidin-4-yl)-1,2,2-trimethylhydrazine |
|---|---|
| PubChem CID | 19609586 |
| Molecular Formula | C10H23N3 |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.19 |
| IUPAC Name | 1-(2,2-dimethylpiperidin-4-yl)-1,2,2-trimethylhydrazine |
| SMILES | CN(C)N(C)C1CCNC(C)(C)C1 |
| InChI | InChI=1S/C10H23N3/c1-10(2)8-9(6-7-11-10)13(5)12(3)4/h9,11H,6-8H2,1-5H3 |
| InChIKey | NBIVPUBZBWFHCF-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|