C12H12N6O6 — CID 19609599
1-(6,6,6-triisocyanatohexyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 19609599) has the molecular formula C12H12N6O6 and a molecular weight of 336.26 g/mol. Its IUPAC name is 1-(6,6,6-triisocyanatohexyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-(6,6,6-triisocyanatohexyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 19609599 |
| Molecular Formula | C12H12N6O6 |
| Molecular Weight | 336.26 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 1-(6,6,6-triisocyanatohexyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=C=NC(CCCCCn1c(=O)[nH]c(=O)[nH]c1=O)(N=C=O)N=C=O |
| InChI | InChI=1S/C12H12N6O6/c19-6-13-12(14-7-20,15-8-21)4-2-1-3-5-18-10(23)16-9(22)17-11(18)24/h1-5H2,(H2,16,17,22,23,24) |
| InChIKey | OTASGZNHSUDPGO-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 176.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.26 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|