About nitrobenzene
nitrobenzene (PubChem CID 19609690) has the molecular formula C12H10N2O4
and a molecular weight of 246.22 g/mol. Its IUPAC name is nitrobenzene.
Molecular Properties
| Compound Name | nitrobenzene |
| PubChem CID | 19609690 |
| Molecular Formula | C12H10N2O4 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | nitrobenzene |
| SMILES | O=[N+]([O-])c1ccccc1.O=[N+]([O-])c1ccccc1 |
| InChI | InChI=1S/2C6H5NO2/c2*8-7(9)6-4-2-1-3-5-6/h2*1-5H |
| InChIKey | BEJBETAAAVFGOR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitrobenzene?
The IUPAC name of nitrobenzene (CID 19609690) is nitrobenzene.
What is the SMILES notation for nitrobenzene?
The canonical SMILES for nitrobenzene is O=[N+]([O-])c1ccccc1.O=[N+]([O-])c1ccccc1.
What is the InChIKey of nitrobenzene?
The InChIKey is BEJBETAAAVFGOR-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H5NO2/c2*8-7(9)6-4-2-1-3-5-6/h2*1-5H.
What are the key properties of nitrobenzene?
nitrobenzene has a molecular weight of 246.22 g/mol, XLogP of 3.19, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for nitrobenzene is sourced from PubChem (CID 19609690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).