(Z)-2-sulfopent-2-enoic acid

C5H8O5S — CID 19609775

IUPAC(Z)-2-sulfopent-2-enoic acid
SMILESCC/C=C(/C(=O)O)S(=O)(=O)O
InChIInChI=1S/C5H8O5S/c1-2-3-4(5(6)7)11(8,9)10/h3H,2H2,1H3,(H,6,7)(H,8,9,10)/b4-3-
InChIKeyWOWHVVMWCVMXRU-ARJAWSKDSA-N
MW180.18 g/mol
LogP0.25
Rot. Bonds3

About (Z)-2-sulfopent-2-enoic acid

(Z)-2-sulfopent-2-enoic acid (PubChem CID 19609775) has the molecular formula C5H8O5S and a molecular weight of 180.18 g/mol. Its IUPAC name is (Z)-2-sulfopent-2-enoic acid.

Molecular Properties

Compound Name(Z)-2-sulfopent-2-enoic acid
PubChem CID19609775
Molecular FormulaC5H8O5S
Molecular Weight180.18 g/mol
Exact Mass180.01
IUPAC Name(Z)-2-sulfopent-2-enoic acid
SMILESCC/C=C(/C(=O)O)S(=O)(=O)O
InChIInChI=1S/C5H8O5S/c1-2-3-4(5(6)7)11(8,9)10/h3H,2H2,1H3,(H,6,7)(H,8,9,10)/b4-3-
InChIKeyWOWHVVMWCVMXRU-ARJAWSKDSA-N
XLogP0.25
TPSA91.67 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.18
LogP ≤ 50.25
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze (Z)-2-sulfopent-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-2-sulfopent-2-enoic acid?
The IUPAC name of (Z)-2-sulfopent-2-enoic acid (CID 19609775) is (Z)-2-sulfopent-2-enoic acid.
What is the SMILES notation for (Z)-2-sulfopent-2-enoic acid?
The canonical SMILES for (Z)-2-sulfopent-2-enoic acid is CC/C=C(/C(=O)O)S(=O)(=O)O.
What is the InChIKey of (Z)-2-sulfopent-2-enoic acid?
The InChIKey is WOWHVVMWCVMXRU-ARJAWSKDSA-N. The full InChI is InChI=1S/C5H8O5S/c1-2-3-4(5(6)7)11(8,9)10/h3H,2H2,1H3,(H,6,7)(H,8,9,10)/b4-3-.
What are the key properties of (Z)-2-sulfopent-2-enoic acid?
(Z)-2-sulfopent-2-enoic acid has a molecular weight of 180.18 g/mol, XLogP of 0.25, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-sulfopent-2-enoic acid is sourced from PubChem (CID 19609775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).