C10H17ClN4 — CID 19610889
3-(4-methyltriazol-2-yl)-1-azabicyclo[2.2.2]octane;hydrochloride (PubChem CID 19610889) has the molecular formula C10H17ClN4 and a molecular weight of 228.73 g/mol. Its IUPAC name is 3-(4-methyltriazol-2-yl)-1-azabicyclo[2.2.2]octane;hydrochloride.
| Compound Name | 3-(4-methyltriazol-2-yl)-1-azabicyclo[2.2.2]octane;hydrochloride |
|---|---|
| PubChem CID | 19610889 |
| Molecular Formula | C10H17ClN4 |
| Molecular Weight | 228.73 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 3-(4-methyltriazol-2-yl)-1-azabicyclo[2.2.2]octane;hydrochloride |
| SMILES | Cc1cnn(C2CN3CCC2CC3)n1.Cl |
| InChI | InChI=1S/C10H16N4.ClH/c1-8-6-11-14(12-8)10-7-13-4-2-9(10)3-5-13;/h6,9-10H,2-5,7H2,1H3;1H |
| InChIKey | PDEBSFJDEAJINE-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.73 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |