About (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl acetate
(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl acetate (PubChem CID 19611268) has the molecular formula C7H8O5
and a molecular weight of 172.14 g/mol. Its IUPAC name is (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl acetate.
Molecular Properties
| Compound Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl acetate |
| PubChem CID | 19611268 |
| Molecular Formula | C7H8O5 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl acetate |
| SMILES | CC(=O)OCc1oc(=O)oc1C |
| InChI | InChI=1S/C7H8O5/c1-4-6(3-10-5(2)8)12-7(9)11-4/h3H2,1-2H3 |
| InChIKey | UHZFGTXFKBGFMX-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 69.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl acetate?
The IUPAC name of (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl acetate (CID 19611268) is (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl acetate.
What is the SMILES notation for (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl acetate?
The canonical SMILES for (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl acetate is CC(=O)OCc1oc(=O)oc1C.
What is the InChIKey of (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl acetate?
The InChIKey is UHZFGTXFKBGFMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O5/c1-4-6(3-10-5(2)8)12-7(9)11-4/h3H2,1-2H3.
What are the key properties of (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl acetate?
(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl acetate has a molecular weight of 172.14 g/mol, XLogP of 0.60, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl acetate is sourced from PubChem (CID 19611268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).